C26H21F2N5O — CID 69333492
8-(3-fluorophenyl)-N-(1-fluoro-2-phenylethyl)-9-(3-methoxyphenyl)purin-2-amine (PubChem CID 69333492) has the molecular formula C26H21F2N5O and a molecular weight of 457.48 g/mol. Its IUPAC name is 8-(3-fluorophenyl)-N-(1-fluoro-2-phenylethyl)-9-(3-methoxyphenyl)purin-2-amine.
| Compound Name | 8-(3-fluorophenyl)-N-(1-fluoro-2-phenylethyl)-9-(3-methoxyphenyl)purin-2-amine |
|---|---|
| PubChem CID | 69333492 |
| Molecular Formula | C26H21F2N5O |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 8-(3-fluorophenyl)-N-(1-fluoro-2-phenylethyl)-9-(3-methoxyphenyl)purin-2-amine |
| SMILES | COc1cccc(-n2c(-c3cccc(F)c3)nc3cnc(NC(F)Cc4ccccc4)nc32)c1 |
| InChI | InChI=1S/C26H21F2N5O/c1-34-21-12-6-11-20(15-21)33-24(18-9-5-10-19(27)14-18)30-22-16-29-26(32-25(22)33)31-23(28)13-17-7-3-2-4-8-17/h2-12,14-16,23H,13H2,1H3,(H,29,31,32) |
| InChIKey | SUPZAQMTTLSATL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|