C18H16FN7 — CID 142780240
8-(2-amino-4-pyridinyl)-9-ethyl-6-(4-fluorophenyl)purin-2-amine (PubChem CID 142780240) has the molecular formula C18H16FN7 and a molecular weight of 349.37 g/mol. Its IUPAC name is 8-(2-amino-4-pyridinyl)-9-ethyl-6-(4-fluorophenyl)purin-2-amine.
| Compound Name | 8-(2-amino-4-pyridinyl)-9-ethyl-6-(4-fluorophenyl)purin-2-amine |
|---|---|
| PubChem CID | 142780240 |
| Molecular Formula | C18H16FN7 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 8-(2-amino-4-pyridinyl)-9-ethyl-6-(4-fluorophenyl)purin-2-amine |
| SMILES | CCn1c(-c2ccnc(N)c2)nc2c(-c3ccc(F)cc3)nc(N)nc21 |
| InChI | InChI=1S/C18H16FN7/c1-2-26-16(11-7-8-22-13(20)9-11)23-15-14(24-18(21)25-17(15)26)10-3-5-12(19)6-4-10/h3-9H,2H2,1H3,(H2,20,22)(H2,21,24,25) |
| InChIKey | SJVCDYIFKWTWBL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |