C15H13FN4OS — CID 154699548
4-[5-(4-fluorophenyl)-2-methylsulfinyl-1H-imidazol-4-yl]pyridin-2-amine (PubChem CID 154699548) has the molecular formula C15H13FN4OS and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-2-methylsulfinyl-1H-imidazol-4-yl]pyridin-2-amine.
| Compound Name | 4-[5-(4-fluorophenyl)-2-methylsulfinyl-1H-imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 154699548 |
| Molecular Formula | C15H13FN4OS |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-2-methylsulfinyl-1H-imidazol-4-yl]pyridin-2-amine |
| SMILES | CS(=O)c1nc(-c2ccnc(N)c2)c(-c2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C15H13FN4OS/c1-22(21)15-19-13(9-2-4-11(16)5-3-9)14(20-15)10-6-7-18-12(17)8-10/h2-8H,1H3,(H2,17,18)(H,19,20) |
| InChIKey | DEVKGTPEZICAAL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |