C20H16ClF2N5 — CID 24857020
8-[(2-chlorophenyl)methyl]-N-(2,6-difluorophenyl)-9-ethylpurin-2-amine (PubChem CID 24857020) has the molecular formula C20H16ClF2N5 and a molecular weight of 399.83 g/mol. Its IUPAC name is 8-[(2-chlorophenyl)methyl]-N-(2,6-difluorophenyl)-9-ethylpurin-2-amine.
| Compound Name | 8-[(2-chlorophenyl)methyl]-N-(2,6-difluorophenyl)-9-ethylpurin-2-amine |
|---|---|
| PubChem CID | 24857020 |
| Molecular Formula | C20H16ClF2N5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 8-[(2-chlorophenyl)methyl]-N-(2,6-difluorophenyl)-9-ethylpurin-2-amine |
| SMILES | CCn1c(Cc2ccccc2Cl)nc2cnc(Nc3c(F)cccc3F)nc21 |
| InChI | InChI=1S/C20H16ClF2N5/c1-2-28-17(10-12-6-3-4-7-13(12)21)25-16-11-24-20(27-19(16)28)26-18-14(22)8-5-9-15(18)23/h3-9,11H,2,10H2,1H3,(H,24,26,27) |
| InChIKey | PIKSSZLDQCYOQZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |