C17H15ClN4O3S — CID 130296059
2-[[5-chloro-2-(2-methoxyanilino)pyrimidin-4-yl]amino]benzenesulfinic acid (PubChem CID 130296059) has the molecular formula C17H15ClN4O3S and a molecular weight of 390.85 g/mol. Its IUPAC name is 2-[[5-chloro-2-(2-methoxyanilino)pyrimidin-4-yl]amino]benzenesulfinic acid.
| Compound Name | 2-[[5-chloro-2-(2-methoxyanilino)pyrimidin-4-yl]amino]benzenesulfinic acid |
|---|---|
| PubChem CID | 130296059 |
| Molecular Formula | C17H15ClN4O3S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-[[5-chloro-2-(2-methoxyanilino)pyrimidin-4-yl]amino]benzenesulfinic acid |
| SMILES | COc1ccccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)O)n1 |
| InChI | InChI=1S/C17H15ClN4O3S/c1-25-14-8-4-2-6-12(14)21-17-19-10-11(18)16(22-17)20-13-7-3-5-9-15(13)26(23)24/h2-10H,1H3,(H,23,24)(H2,19,20,21,22) |
| InChIKey | OVLBHZBTDIWNFY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|