About 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one
2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one (PubChem CID 87278369) has the molecular formula C18H29ClN4O2Si
and a molecular weight of 397.00 g/mol. Its IUPAC name is 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one.
Molecular Properties
| Compound Name | 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one |
| PubChem CID | 87278369 |
| Molecular Formula | C18H29ClN4O2Si |
| Molecular Weight | 397.00 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one |
| SMILES | C[C@@H]1CCCC[C@@H]1n1c(=O)n(COCC[Si](C)(C)C)c2cnc(Cl)nc21 |
| InChI | InChI=1S/C18H29ClN4O2Si/c1-13-7-5-6-8-14(13)23-16-15(11-20-17(19)21-16)22(18(23)24)12-25-9-10-26(2,3)4/h11,13-14H,5-10,12H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | OCFAOQHTVVDKCM-KGLIPLIRSA-N |
| XLogP | 4.31 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one?
The IUPAC name of 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one (CID 87278369) is 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one.
What is the SMILES notation for 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one?
The canonical SMILES for 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one is C[C@@H]1CCCC[C@@H]1n1c(=O)n(COCC[Si](C)(C)C)c2cnc(Cl)nc21.
What is the InChIKey of 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one?
The InChIKey is OCFAOQHTVVDKCM-KGLIPLIRSA-N. The full InChI is InChI=1S/C18H29ClN4O2Si/c1-13-7-5-6-8-14(13)23-16-15(11-20-17(19)21-16)22(18(23)24)12-25-9-10-26(2,3)4/h11,13-14H,5-10,12H2,1-4H3/t13-,14+/m1/s1.
What are the key properties of 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one?
2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one has a molecular weight of 397.00 g/mol, XLogP of 4.31, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one is sourced from PubChem (CID 87278369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).