C22H33N3OSi — CID 58115017
trimethyl-[2-[[12-(2-methylcyclohexyl)-1,5,7-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane (PubChem CID 58115017) has the molecular formula C22H33N3OSi and a molecular weight of 383.61 g/mol. Its IUPAC name is trimethyl-[2-[[12-(2-methylcyclohexyl)-1,5,7-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[12-(2-methylcyclohexyl)-1,5,7-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 58115017 |
| Molecular Formula | C22H33N3OSi |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | trimethyl-[2-[[12-(2-methylcyclohexyl)-1,5,7-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane |
| SMILES | CC1CCCCC1c1ccc2cnc3c(ccn3COCC[Si](C)(C)C)n12 |
| InChI | InChI=1S/C22H33N3OSi/c1-17-7-5-6-8-19(17)20-10-9-18-15-23-22-21(25(18)20)11-12-24(22)16-26-13-14-27(2,3)4/h9-12,15,17,19H,5-8,13-14,16H2,1-4H3 |
| InChIKey | BLLBXMOPCRFOFR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|