C19H27N5O2Si — CID 86678481
cis-(3R,4S)-3-methyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-one (PubChem CID 86678481) has the molecular formula C19H27N5O2Si and a molecular weight of 385.54 g/mol. Its IUPAC name is cis-(3R,4S)-3-methyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-one.
| Compound Name | cis-(3R,4S)-3-methyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 86678481 |
| Molecular Formula | C19H27N5O2Si |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | cis-(3R,4S)-3-methyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-one |
| SMILES | C[C@@H]1CC(=O)C[C@@H]1c1nnc2cnc3c(ccn3COCC[Si](C)(C)C)n12 |
| InChI | InChI=1S/C19H27N5O2Si/c1-13-9-14(25)10-15(13)18-22-21-17-11-20-19-16(24(17)18)5-6-23(19)12-26-7-8-27(2,3)4/h5-6,11,13,15H,7-10,12H2,1-4H3/t13-,15+/m1/s1 |
| InChIKey | FGFSKVVASLNQJE-HIFRSBDPSA-N |
| XLogP | 3.47 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|