C22H30N6OSi — CID 89439353
(E)-3-[(1S,3R,4S)-3-methyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]prop-2-enenitrile (PubChem CID 89439353) has the molecular formula C22H30N6OSi and a molecular weight of 422.61 g/mol. Its IUPAC name is (E)-3-[(1S,3R,4S)-3-methyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]prop-2-enenitrile.
| Compound Name | (E)-3-[(1S,3R,4S)-3-methyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 89439353 |
| Molecular Formula | C22H30N6OSi |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (E)-3-[(1S,3R,4S)-3-methyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]prop-2-enenitrile |
| SMILES | C[C@@H]1C[C@H](/C=C/C#N)C[C@@H]1c1nnc2cnc3c(ccn3COCC[Si](C)(C)C)n12 |
| InChI | InChI=1S/C22H30N6OSi/c1-16-12-17(6-5-8-23)13-18(16)21-26-25-20-14-24-22-19(28(20)21)7-9-27(22)15-29-10-11-30(2,3)4/h5-7,9,14,16-18H,10-13,15H2,1-4H3/b6-5+/t16-,17+,18+/m1/s1 |
| InChIKey | MKHKGZRXTXOSFF-BDINKKKZSA-N |
| XLogP | 4.60 |
| TPSA | 81.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|