C18H24N4OSi — CID 175852802
3-[4-(pyridin-4-ylmethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enenitrile (PubChem CID 175852802) has the molecular formula C18H24N4OSi and a molecular weight of 340.50 g/mol. Its IUPAC name is 3-[4-(pyridin-4-ylmethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[4-(pyridin-4-ylmethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 175852802 |
| Molecular Formula | C18H24N4OSi |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-[4-(pyridin-4-ylmethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enenitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(Cc2ccncc2)nc1C=CC#N |
| InChI | InChI=1S/C18H24N4OSi/c1-24(2,3)12-11-23-15-22-14-17(21-18(22)5-4-8-19)13-16-6-9-20-10-7-16/h4-7,9-10,14H,11-13,15H2,1-3H3 |
| InChIKey | CXKGYGDYVRTAAJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|