C13H21N3O3Si — CID 86718427
[2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol (PubChem CID 86718427) has the molecular formula C13H21N3O3Si and a molecular weight of 295.42 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol.
| Compound Name | [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 86718427 |
| Molecular Formula | C13H21N3O3Si |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1cc(CO)nc1-c1ccon1 |
| InChI | InChI=1S/C13H21N3O3Si/c1-20(2,3)7-6-18-10-16-8-11(9-17)14-13(16)12-4-5-19-15-12/h4-5,8,17H,6-7,9-10H2,1-3H3 |
| InChIKey | AXDRJWBFGJGFFG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|