About [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol
[2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol (PubChem CID 86718427) has the molecular formula C13H21N3O3Si
and a molecular weight of 295.42 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol |
| PubChem CID | 86718427 |
| Molecular Formula | C13H21N3O3Si |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1cc(CO)nc1-c1ccon1 |
| InChI | InChI=1S/C13H21N3O3Si/c1-20(2,3)7-6-18-10-16-8-11(9-17)14-13(16)12-4-5-19-15-12/h4-5,8,17H,6-7,9-10H2,1-3H3 |
| InChIKey | AXDRJWBFGJGFFG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol?
The IUPAC name of [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol (CID 86718427) is [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol.
What is the SMILES notation for [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol?
The canonical SMILES for [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol is C[Si](C)(C)CCOCn1cc(CO)nc1-c1ccon1.
What is the InChIKey of [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol?
The InChIKey is AXDRJWBFGJGFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3Si/c1-20(2,3)7-6-18-10-16-8-11(9-17)14-13(16)12-4-5-19-15-12/h4-5,8,17H,6-7,9-10H2,1-3H3.
What are the key properties of [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol?
[2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol has a molecular weight of 295.42 g/mol, XLogP of 2.34, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,2-oxazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methanol is sourced from PubChem (CID 86718427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).