C16H23F3N4OSi — CID 162566497
2-[[2-(5-ethylpyrimidin-2-yl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 162566497) has the molecular formula C16H23F3N4OSi and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[[2-(5-ethylpyrimidin-2-yl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(5-ethylpyrimidin-2-yl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 162566497 |
| Molecular Formula | C16H23F3N4OSi |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[[2-(5-ethylpyrimidin-2-yl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCc1cnc(-c2nc(C(F)(F)F)cn2COCC[Si](C)(C)C)nc1 |
| InChI | InChI=1S/C16H23F3N4OSi/c1-5-12-8-20-14(21-9-12)15-22-13(16(17,18)19)10-23(15)11-24-6-7-25(2,3)4/h8-10H,5-7,11H2,1-4H3 |
| InChIKey | LZJOIKCADNYIAV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|