C17H22F3N3O4Si — CID 169086392
[3-nitro-4-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]methanol (PubChem CID 169086392) has the molecular formula C17H22F3N3O4Si and a molecular weight of 417.46 g/mol. Its IUPAC name is [3-nitro-4-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]methanol.
| Compound Name | [3-nitro-4-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 169086392 |
| Molecular Formula | C17H22F3N3O4Si |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [3-nitro-4-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]methanol |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)nc1-c1ccc(CO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22F3N3O4Si/c1-28(2,3)7-6-27-11-22-9-15(17(18,19)20)21-16(22)13-5-4-12(10-24)8-14(13)23(25)26/h4-5,8-9,24H,6-7,10-11H2,1-3H3 |
| InChIKey | HSNQGAUDXCSGSQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|