C15H16BrF4N2OS+ — CID 162566498
2-[[2-(4-bromo-2-fluorophenyl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-dimethylsulfanium (PubChem CID 162566498) has the molecular formula C15H16BrF4N2OS+ and a molecular weight of 428.27 g/mol. Its IUPAC name is 2-[[2-(4-bromo-2-fluorophenyl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-dimethylsulfanium.
| Compound Name | 2-[[2-(4-bromo-2-fluorophenyl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 162566498 |
| Molecular Formula | C15H16BrF4N2OS+ |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | 2-[[2-(4-bromo-2-fluorophenyl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-dimethylsulfanium |
| SMILES | C[S+](C)CCOCn1cc(C(F)(F)F)nc1-c1ccc(Br)cc1F |
| InChI | InChI=1S/C15H16BrF4N2OS/c1-24(2)6-5-23-9-22-8-13(15(18,19)20)21-14(22)11-4-3-10(16)7-12(11)17/h3-4,7-8H,5-6,9H2,1-2H3/q+1 |
| InChIKey | QWIXQKWEJQGLIX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|