C11H7BrF4N2 — CID 168800104
2-(4-bromo-2-fluorophenyl)-1-methyl-4-(trifluoromethyl)imidazole (PubChem CID 168800104) has the molecular formula C11H7BrF4N2 and a molecular weight of 323.09 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-methyl-4-(trifluoromethyl)imidazole.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-methyl-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 168800104 |
| Molecular Formula | C11H7BrF4N2 |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-methyl-4-(trifluoromethyl)imidazole |
| SMILES | Cn1cc(C(F)(F)F)nc1-c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H7BrF4N2/c1-18-5-9(11(14,15)16)17-10(18)7-3-2-6(12)4-8(7)13/h2-5H,1H3 |
| InChIKey | IVQPQUWIWHEORP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |