C16H22F4N2OSi — CID 123576928
2-[[2-(2-fluorohexa-1,3,5-trien-3-yl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123576928) has the molecular formula C16H22F4N2OSi and a molecular weight of 362.44 g/mol. Its IUPAC name is 2-[[2-(2-fluorohexa-1,3,5-trien-3-yl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(2-fluorohexa-1,3,5-trien-3-yl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123576928 |
| Molecular Formula | C16H22F4N2OSi |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[[2-(2-fluorohexa-1,3,5-trien-3-yl)-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C=CC=C(C(=C)F)c1nc(C(F)(F)F)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H22F4N2OSi/c1-6-7-13(12(2)17)15-21-14(16(18,19)20)10-22(15)11-23-8-9-24(3,4)5/h6-7,10H,1-2,8-9,11H2,3-5H3 |
| InChIKey | GNXIETNRQILWOI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|