C30H38F3N3O3Si — CID 162190634
1-[(1S,3R)-3-[4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]phenoxy]cyclohexyl]propan-2-one (PubChem CID 162190634) has the molecular formula C30H38F3N3O3Si and a molecular weight of 573.73 g/mol. Its IUPAC name is 1-[(1S,3R)-3-[4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]phenoxy]cyclohexyl]propan-2-one.
| Compound Name | 1-[(1S,3R)-3-[4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]phenoxy]cyclohexyl]propan-2-one |
|---|---|
| PubChem CID | 162190634 |
| Molecular Formula | C30H38F3N3O3Si |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | 1-[(1S,3R)-3-[4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]phenoxy]cyclohexyl]propan-2-one |
| SMILES | CC(=O)C[C@H]1CCC[C@@H](Oc2ccc(-c3ccc(-c4nc(C(F)(F)F)cn4COCC[Si](C)(C)C)nc3)cc2)C1 |
| InChI | InChI=1S/C30H38F3N3O3Si/c1-21(37)16-22-6-5-7-26(17-22)39-25-11-8-23(9-12-25)24-10-13-27(34-18-24)29-35-28(30(31,32)33)19-36(29)20-38-14-15-40(2,3)4/h8-13,18-19,22,26H,5-7,14-17,20H2,1-4H3/t22-,26-/m1/s1 |
| InChIKey | WDGLUVAYFXIINE-ATIYNZHBSA-N |
| XLogP | 7.86 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|