C30H38F3N3O2Si — CID 159438084
1-[4-[4-[4-[5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]phenyl]cyclohexyl]propan-2-one (PubChem CID 159438084) has the molecular formula C30H38F3N3O2Si and a molecular weight of 557.73 g/mol. Its IUPAC name is 1-[4-[4-[4-[5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]phenyl]cyclohexyl]propan-2-one.
| Compound Name | 1-[4-[4-[4-[5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]phenyl]cyclohexyl]propan-2-one |
|---|---|
| PubChem CID | 159438084 |
| Molecular Formula | C30H38F3N3O2Si |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 1-[4-[4-[4-[5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]phenyl]cyclohexyl]propan-2-one |
| SMILES | CC(=O)CC1CCC(c2ccc(-c3ccc(-c4nc(C(F)(F)F)n(COCC[Si](C)(C)C)n4)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H38F3N3O2Si/c1-21(37)19-22-5-7-23(8-6-22)24-9-11-25(12-10-24)26-13-15-27(16-14-26)28-34-29(30(31,32)33)36(35-28)20-38-17-18-39(2,3)4/h9-16,22-23H,5-8,17-20H2,1-4H3 |
| InChIKey | JUCNTUHOQIOEEY-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|