C27H33F3N4O3Si — CID 162563663
2-[4-[4-[5-[1-(2-dimethylsilylethoxymethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]phenyl]cyclohexyl]acetic acid (PubChem CID 162563663) has the molecular formula C27H33F3N4O3Si and a molecular weight of 546.67 g/mol. Its IUPAC name is 2-[4-[4-[5-[1-(2-dimethylsilylethoxymethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[5-[1-(2-dimethylsilylethoxymethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 162563663 |
| Molecular Formula | C27H33F3N4O3Si |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 2-[4-[4-[5-[1-(2-dimethylsilylethoxymethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]phenyl]cyclohexyl]acetic acid |
| SMILES | C[SiH](C)CCOCn1nc(-c2ccc(-c3ccc(C4CCC(CC(=O)O)CC4)cc3)nc2)nc1C(F)(F)F |
| InChI | InChI=1S/C27H33F3N4O3Si/c1-38(2)14-13-37-17-34-26(27(28,29)30)32-25(33-34)22-11-12-23(31-16-22)21-9-7-20(8-10-21)19-5-3-18(4-6-19)15-24(35)36/h7-12,16,18-19,38H,3-6,13-15,17H2,1-2H3,(H,35,36) |
| InChIKey | IXIPAQNBRMBQBE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|