C18H33N3O3Si — CID 156676897
5-(3-hydroxypropyl)-3-piperidin-1-yl-1-(2-trimethylsilylethoxymethyl)pyrazin-2-one (PubChem CID 156676897) has the molecular formula C18H33N3O3Si and a molecular weight of 367.57 g/mol. Its IUPAC name is 5-(3-hydroxypropyl)-3-piperidin-1-yl-1-(2-trimethylsilylethoxymethyl)pyrazin-2-one.
| Compound Name | 5-(3-hydroxypropyl)-3-piperidin-1-yl-1-(2-trimethylsilylethoxymethyl)pyrazin-2-one |
|---|---|
| PubChem CID | 156676897 |
| Molecular Formula | C18H33N3O3Si |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 5-(3-hydroxypropyl)-3-piperidin-1-yl-1-(2-trimethylsilylethoxymethyl)pyrazin-2-one |
| SMILES | C[Si](C)(C)CCOCn1cc(CCCO)nc(N2CCCCC2)c1=O |
| InChI | InChI=1S/C18H33N3O3Si/c1-25(2,3)13-12-24-15-21-14-16(8-7-11-22)19-17(18(21)23)20-9-5-4-6-10-20/h14,22H,4-13,15H2,1-3H3 |
| InChIKey | IFFITDOSGXIZQT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|