C20H36N6O2Si — CID 175266712
trimethyl-[2-[[4-methyl-2-[2-(1-methyl-2-piperazin-1-ylimidazol-4-yl)ethoxy]imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 175266712) has the molecular formula C20H36N6O2Si and a molecular weight of 420.63 g/mol. Its IUPAC name is trimethyl-[2-[[4-methyl-2-[2-(1-methyl-2-piperazin-1-ylimidazol-4-yl)ethoxy]imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-methyl-2-[2-(1-methyl-2-piperazin-1-ylimidazol-4-yl)ethoxy]imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 175266712 |
| Molecular Formula | C20H36N6O2Si |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | trimethyl-[2-[[4-methyl-2-[2-(1-methyl-2-piperazin-1-ylimidazol-4-yl)ethoxy]imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1cn(COCC[Si](C)(C)C)c(OCCc2cn(C)c(N3CCNCC3)n2)n1 |
| InChI | InChI=1S/C20H36N6O2Si/c1-17-14-26(16-27-12-13-29(3,4)5)20(22-17)28-11-6-18-15-24(2)19(23-18)25-9-7-21-8-10-25/h14-15,21H,6-13,16H2,1-5H3 |
| InChIKey | LTGMJOFQVNNQHI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|