C13H22N4O — CID 106551915
(3aS,6aS)-1-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 106551915) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is (3aS,6aS)-1-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 106551915 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (3aS,6aS)-1-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | COCCn1cc(C)nc1N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C13H22N4O/c1-10-9-16(5-6-18-2)13(15-10)17-4-3-11-7-14-8-12(11)17/h9,11-12,14H,3-8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | URJAERDSFSZLGU-NWDGAFQWSA-N |
| XLogP | 0.64 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |