C12H18N4O — CID 113357064
(3aS,6aS)-1-(4-ethoxypyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 113357064) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is (3aS,6aS)-1-(4-ethoxypyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-(4-ethoxypyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 113357064 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (3aS,6aS)-1-(4-ethoxypyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | CCOc1ccnc(N2CC[C@H]3CNC[C@H]32)n1 |
| InChI | InChI=1S/C12H18N4O/c1-2-17-11-3-5-14-12(15-11)16-6-4-9-7-13-8-10(9)16/h3,5,9-10,13H,2,4,6-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | WJHLPPHAJKPFDQ-VHSXEESVSA-N |
| XLogP | 0.67 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |