C10H14Cl2N4 — CID 154908067
(3aS,6aS)-1-(5-chloropyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;hydrochloride (PubChem CID 154908067) has the molecular formula C10H14Cl2N4 and a molecular weight of 261.16 g/mol. Its IUPAC name is (3aS,6aS)-1-(5-chloropyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;hydrochloride.
| Compound Name | (3aS,6aS)-1-(5-chloropyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 154908067 |
| Molecular Formula | C10H14Cl2N4 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (3aS,6aS)-1-(5-chloropyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;hydrochloride |
| SMILES | Cl.Clc1cnc(N2CC[C@H]3CNC[C@H]32)nc1 |
| InChI | InChI=1S/C10H13ClN4.ClH/c11-8-4-13-10(14-5-8)15-2-1-7-3-12-6-9(7)15;/h4-5,7,9,12H,1-3,6H2;1H/t7-,9+;/m0./s1 |
| InChIKey | BHTFTHRAAAYCAA-DKXTVVGFSA-N |
| XLogP | 1.35 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |