C9H15N5 — CID 131182459
(3aR,6aR)-1-(3-methyltriazol-4-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 131182459) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3aR,6aR)-1-(3-methyltriazol-4-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-1-(3-methyltriazol-4-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 131182459 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (3aR,6aR)-1-(3-methyltriazol-4-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | Cn1nncc1N1CC[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C9H15N5/c1-13-9(6-11-12-13)14-3-2-7-4-10-5-8(7)14/h6-8,10H,2-5H2,1H3/t7-,8+/m1/s1 |
| InChIKey | KHNXAOONXAJORS-SFYZADRCSA-N |
| XLogP | -0.39 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |