C15H18ClN3O4 — CID 173015125
(3aR,6aR)-1-(6-chloro-3-pyridinyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;but-2-enedioic acid (PubChem CID 173015125) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is (3aR,6aR)-1-(6-chloro-3-pyridinyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;but-2-enedioic acid.
| Compound Name | (3aR,6aR)-1-(6-chloro-3-pyridinyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;but-2-enedioic acid |
|---|---|
| PubChem CID | 173015125 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (3aR,6aR)-1-(6-chloro-3-pyridinyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole;but-2-enedioic acid |
| SMILES | Clc1ccc(N2CC[C@@H]3CNC[C@@H]32)cn1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C11H14ClN3.C4H4O4/c12-11-2-1-9(6-14-11)15-4-3-8-5-13-7-10(8)15;5-3(6)1-2-4(7)8/h1-2,6,8,10,13H,3-5,7H2;1-2H,(H,5,6)(H,7,8)/t8-,10+;/m1./s1 |
| InChIKey | WIGYEOKOIXZUED-SCYNACPDSA-N |
| XLogP | 1.24 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|