C19H19BrN4O8 — CID 23634912
2-bromo-5-[(1R,5S)-3,6-diazabicyclo[3.2.0]heptan-6-yl]pyridine-3-carbonitrile;bis((E)-but-2-enedioic acid) (PubChem CID 23634912) has the molecular formula C19H19BrN4O8 and a molecular weight of 511.29 g/mol. Its IUPAC name is 2-bromo-5-[(1R,5S)-3,6-diazabicyclo[3.2.0]heptan-6-yl]pyridine-3-carbonitrile;bis((E)-but-2-enedioic acid).
| Compound Name | 2-bromo-5-[(1R,5S)-3,6-diazabicyclo[3.2.0]heptan-6-yl]pyridine-3-carbonitrile;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 23634912 |
| Molecular Formula | C19H19BrN4O8 |
| Molecular Weight | 511.29 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 2-bromo-5-[(1R,5S)-3,6-diazabicyclo[3.2.0]heptan-6-yl]pyridine-3-carbonitrile;bis((E)-but-2-enedioic acid) |
| SMILES | N#Cc1cc(N2C[C@H]3CNC[C@H]32)cnc1Br.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H11BrN4.2C4H4O4/c12-11-7(2-13)1-9(4-15-11)16-6-8-3-14-5-10(8)16;2*5-3(6)1-2-4(7)8/h1,4,8,10,14H,3,5-6H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+/t8-,10-;;/m1../s1 |
| InChIKey | AYPFTGZFDONPCP-RPWWDZGESA-N |
| XLogP | 0.55 |
| TPSA | 201.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|