C11H13Cl2N3 — CID 87137238
(1S,6S)-7-(5,6-dichloro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane (PubChem CID 87137238) has the molecular formula C11H13Cl2N3 and a molecular weight of 258.15 g/mol. Its IUPAC name is (1S,6S)-7-(5,6-dichloro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane.
| Compound Name | (1S,6S)-7-(5,6-dichloro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 87137238 |
| Molecular Formula | C11H13Cl2N3 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (1S,6S)-7-(5,6-dichloro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane |
| SMILES | Clc1cc(N2C[C@@H]3CNCC[C@@H]32)cnc1Cl |
| InChI | InChI=1S/C11H13Cl2N3/c12-9-3-8(5-15-11(9)13)16-6-7-4-14-2-1-10(7)16/h3,5,7,10,14H,1-2,4,6H2/t7-,10-/m0/s1 |
| InChIKey | WYMGCHPOMQGPPC-XVKPBYJWSA-N |
| XLogP | 2.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|