C11H14Cl3N3 — CID 87785000
(6aS)-5-(5,6-dichloro-3-pyridinyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride (PubChem CID 87785000) has the molecular formula C11H14Cl3N3 and a molecular weight of 294.61 g/mol. Its IUPAC name is (6aS)-5-(5,6-dichloro-3-pyridinyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride.
| Compound Name | (6aS)-5-(5,6-dichloro-3-pyridinyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 87785000 |
| Molecular Formula | C11H14Cl3N3 |
| Molecular Weight | 294.61 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (6aS)-5-(5,6-dichloro-3-pyridinyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride |
| SMILES | Cl.Clc1cc(N2CC3CCN[C@@H]3C2)cnc1Cl |
| InChI | InChI=1S/C11H13Cl2N3.ClH/c12-9-3-8(4-15-11(9)13)16-5-7-1-2-14-10(7)6-16;/h3-4,7,10,14H,1-2,5-6H2;1H/t7?,10-;/m1./s1 |
| InChIKey | HICHVKKXKFJWOW-DLGLCQKISA-N |
| XLogP | 2.61 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|