C12H15ClFN3 — CID 22646988
5-(6-chloro-5-fluoro-3-pyridinyl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine (PubChem CID 22646988) has the molecular formula C12H15ClFN3 and a molecular weight of 255.72 g/mol. Its IUPAC name is 5-(6-chloro-5-fluoro-3-pyridinyl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine.
| Compound Name | 5-(6-chloro-5-fluoro-3-pyridinyl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 22646988 |
| Molecular Formula | C12H15ClFN3 |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 5-(6-chloro-5-fluoro-3-pyridinyl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine |
| SMILES | Fc1cc(N2CCC3NCCC3C2)cnc1Cl |
| InChI | InChI=1S/C12H15ClFN3/c13-12-10(14)5-9(6-16-12)17-4-2-11-8(7-17)1-3-15-11/h5-6,8,11,15H,1-4,7H2 |
| InChIKey | WSYFMYKZOLWLSD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|