C13H17ClFN3 — CID 22646878
6-(6-chloro-5-fluoro-3-pyridinyl)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[2,3-d]azepine (PubChem CID 22646878) has the molecular formula C13H17ClFN3 and a molecular weight of 269.75 g/mol. Its IUPAC name is 6-(6-chloro-5-fluoro-3-pyridinyl)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[2,3-d]azepine.
| Compound Name | 6-(6-chloro-5-fluoro-3-pyridinyl)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[2,3-d]azepine |
|---|---|
| PubChem CID | 22646878 |
| Molecular Formula | C13H17ClFN3 |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 6-(6-chloro-5-fluoro-3-pyridinyl)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[2,3-d]azepine |
| SMILES | Fc1cc(N2CCC3CCNC3CC2)cnc1Cl |
| InChI | InChI=1S/C13H17ClFN3/c14-13-11(15)7-10(8-17-13)18-5-2-9-1-4-16-12(9)3-6-18/h7-9,12,16H,1-6H2 |
| InChIKey | BZFNONWLZJYWAQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|