C12H15Cl2N3 — CID 22646910
6-(5,6-dichloro-3-pyridinyl)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine (PubChem CID 22646910) has the molecular formula C12H15Cl2N3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 6-(5,6-dichloro-3-pyridinyl)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine.
| Compound Name | 6-(5,6-dichloro-3-pyridinyl)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 22646910 |
| Molecular Formula | C12H15Cl2N3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 6-(5,6-dichloro-3-pyridinyl)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine |
| SMILES | Clc1cc(N2CCC3CCNC3C2)cnc1Cl |
| InChI | InChI=1S/C12H15Cl2N3/c13-10-5-9(6-16-12(10)14)17-4-2-8-1-3-15-11(8)7-17/h5-6,8,11,15H,1-4,7H2 |
| InChIKey | MAHWNRWRZPGLNW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|