C12H15Cl2N3 — CID 87137117
(1R,7S)-3-(5,6-dichloro-3-pyridinyl)-3,9-diazabicyclo[5.2.0]nonane (PubChem CID 87137117) has the molecular formula C12H15Cl2N3 and a molecular weight of 272.18 g/mol. Its IUPAC name is (1R,7S)-3-(5,6-dichloro-3-pyridinyl)-3,9-diazabicyclo[5.2.0]nonane.
| Compound Name | (1R,7S)-3-(5,6-dichloro-3-pyridinyl)-3,9-diazabicyclo[5.2.0]nonane |
|---|---|
| PubChem CID | 87137117 |
| Molecular Formula | C12H15Cl2N3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (1R,7S)-3-(5,6-dichloro-3-pyridinyl)-3,9-diazabicyclo[5.2.0]nonane |
| SMILES | Clc1cc(N2CCC[C@H]3CN[C@H]3C2)cnc1Cl |
| InChI | InChI=1S/C12H15Cl2N3/c13-10-4-9(6-16-12(10)14)17-3-1-2-8-5-15-11(8)7-17/h4,6,8,11,15H,1-3,5,7H2/t8-,11-/m0/s1 |
| InChIKey | AMXTXSUKEIIVAW-KWQFWETISA-N |
| XLogP | 2.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|