C12H16ClN3 — CID 87137606
(1R,7S)-3-(6-chloro-3-pyridinyl)-3,9-diazabicyclo[5.2.0]nonane (PubChem CID 87137606) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is (1R,7S)-3-(6-chloro-3-pyridinyl)-3,9-diazabicyclo[5.2.0]nonane.
| Compound Name | (1R,7S)-3-(6-chloro-3-pyridinyl)-3,9-diazabicyclo[5.2.0]nonane |
|---|---|
| PubChem CID | 87137606 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (1R,7S)-3-(6-chloro-3-pyridinyl)-3,9-diazabicyclo[5.2.0]nonane |
| SMILES | Clc1ccc(N2CCC[C@H]3CN[C@H]3C2)cn1 |
| InChI | InChI=1S/C12H16ClN3/c13-12-4-3-10(7-15-12)16-5-1-2-9-6-14-11(9)8-16/h3-4,7,9,11,14H,1-2,5-6,8H2/t9-,11-/m0/s1 |
| InChIKey | MODMHOBWFCOZDT-ONGXEEELSA-N |
| XLogP | 1.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|