C12H18Cl3N3 — CID 87137232
(4aR,7aR)-6-(6-chloro-3-pyridinyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;dihydrochloride (PubChem CID 87137232) has the molecular formula C12H18Cl3N3 and a molecular weight of 310.66 g/mol. Its IUPAC name is (4aR,7aR)-6-(6-chloro-3-pyridinyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;dihydrochloride.
| Compound Name | (4aR,7aR)-6-(6-chloro-3-pyridinyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 87137232 |
| Molecular Formula | C12H18Cl3N3 |
| Molecular Weight | 310.66 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (4aR,7aR)-6-(6-chloro-3-pyridinyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(N2C[C@H]3CCCN[C@H]3C2)cn1 |
| InChI | InChI=1S/C12H16ClN3.2ClH/c13-12-4-3-10(6-15-12)16-7-9-2-1-5-14-11(9)8-16;;/h3-4,6,9,11,14H,1-2,5,7-8H2;2*1H/t9-,11+;;/m1../s1 |
| InChIKey | HUAAYSKQWOQDGS-SFGLUTOSSA-N |
| XLogP | 2.77 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.66 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|