C11H17Cl4N3 — CID 141075594
3-(6-chloro-3-pyridinyl)-3,8-diazabicyclo[3.2.1]octane;trihydrochloride (PubChem CID 141075594) has the molecular formula C11H17Cl4N3 and a molecular weight of 333.09 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-3,8-diazabicyclo[3.2.1]octane;trihydrochloride.
| Compound Name | 3-(6-chloro-3-pyridinyl)-3,8-diazabicyclo[3.2.1]octane;trihydrochloride |
|---|---|
| PubChem CID | 141075594 |
| Molecular Formula | C11H17Cl4N3 |
| Molecular Weight | 333.09 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-3,8-diazabicyclo[3.2.1]octane;trihydrochloride |
| SMILES | Cl.Cl.Cl.Clc1ccc(N2CC3CCC(C2)N3)cn1 |
| InChI | InChI=1S/C11H14ClN3.3ClH/c12-11-4-3-10(5-13-11)15-6-8-1-2-9(7-15)14-8;;;/h3-5,8-9,14H,1-2,6-7H2;3*1H |
| InChIKey | BQUDXWCLMCTAEQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.09 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|