C15H22N2O2S — CID 102683941
(4aS,7aS)-6-(4-ethylsulfonylphenyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102683941) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is (4aS,7aS)-6-(4-ethylsulfonylphenyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-(4-ethylsulfonylphenyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102683941 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (4aS,7aS)-6-(4-ethylsulfonylphenyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | CCS(=O)(=O)c1ccc(N2C[C@@H]3CCCN[C@@H]3C2)cc1 |
| InChI | InChI=1S/C15H22N2O2S/c1-2-20(18,19)14-7-5-13(6-8-14)17-10-12-4-3-9-16-15(12)11-17/h5-8,12,15-16H,2-4,9-11H2,1H3/t12-,15+/m0/s1 |
| InChIKey | XKAVTALZDGYNNZ-SWLSCSKDSA-N |
| XLogP | 1.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |