C15H23N3O2S — CID 102683641
2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-N-ethylbenzenesulfonamide (PubChem CID 102683641) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-N-ethylbenzenesulfonamide.
| Compound Name | 2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 102683641 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccccc1N1CC2CCCNC2C1 |
| InChI | InChI=1S/C15H23N3O2S/c1-2-17-21(19,20)15-8-4-3-7-14(15)18-10-12-6-5-9-16-13(12)11-18/h3-4,7-8,12-13,16-17H,2,5-6,9-11H2,1H3 |
| InChIKey | BNDZTFURZZSISN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |