C28H30N4O4S — CID 178048048
4-[1-[[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)phenyl]methyl]-3-hydroxy-2-oxoindol-3-yl]benzenesulfonamide (PubChem CID 178048048) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is 4-[1-[[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)phenyl]methyl]-3-hydroxy-2-oxoindol-3-yl]benzenesulfonamide.
| Compound Name | 4-[1-[[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)phenyl]methyl]-3-hydroxy-2-oxoindol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 178048048 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-[1-[[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)phenyl]methyl]-3-hydroxy-2-oxoindol-3-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2(O)C(=O)N(Cc3ccc(N4CC5CCCNC5C4)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H30N4O4S/c29-37(35,36)23-13-9-21(10-14-23)28(34)24-5-1-2-6-26(24)32(27(28)33)16-19-7-11-22(12-8-19)31-17-20-4-3-15-30-25(20)18-31/h1-2,5-14,20,25,30,34H,3-4,15-18H2,(H2,29,35,36) |
| InChIKey | CLECQZGGLRNCMR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|