C24H22N2O6S — CID 178048049
N-[4-[3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-oxoindol-3-yl]phenyl]sulfonylacetamide (PubChem CID 178048049) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is N-[4-[3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-oxoindol-3-yl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-oxoindol-3-yl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 178048049 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[4-[3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-oxoindol-3-yl]phenyl]sulfonylacetamide |
| SMILES | COc1ccc(CN2C(=O)C(O)(c3ccc(S(=O)(=O)NC(C)=O)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H22N2O6S/c1-16(27)25-33(30,31)20-13-9-18(10-14-20)24(29)21-5-3-4-6-22(21)26(23(24)28)15-17-7-11-19(32-2)12-8-17/h3-14,29H,15H2,1-2H3,(H,25,27) |
| InChIKey | JQONBKQEBDGZCC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |