C31H27ClN2O5S — CID 102496463
N-[1-[(3R)-1-benzyl-3-chloro-2-oxoindol-3-yl]-2-(4-methoxyphenyl)-2-oxoethyl]-4-methylbenzenesulfonamide (PubChem CID 102496463) has the molecular formula C31H27ClN2O5S and a molecular weight of 575.09 g/mol. Its IUPAC name is N-[1-[(3R)-1-benzyl-3-chloro-2-oxoindol-3-yl]-2-(4-methoxyphenyl)-2-oxoethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-[(3R)-1-benzyl-3-chloro-2-oxoindol-3-yl]-2-(4-methoxyphenyl)-2-oxoethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102496463 |
| Molecular Formula | C31H27ClN2O5S |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | N-[1-[(3R)-1-benzyl-3-chloro-2-oxoindol-3-yl]-2-(4-methoxyphenyl)-2-oxoethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(C(=O)C(NS(=O)(=O)c2ccc(C)cc2)[C@@]2(Cl)C(=O)N(Cc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H27ClN2O5S/c1-21-12-18-25(19-13-21)40(37,38)33-29(28(35)23-14-16-24(39-2)17-15-23)31(32)26-10-6-7-11-27(26)34(30(31)36)20-22-8-4-3-5-9-22/h3-19,29,33H,20H2,1-2H3/t29?,31-/m1/s1 |
| InChIKey | XVJOHJYBOOSSDJ-ZGVDRVBQSA-N |
| XLogP | 5.21 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|