C25H23NO3 — CID 7281362
(3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-[(2S)-1-oxo-1-phenylpropan-2-yl]indol-2-one (PubChem CID 7281362) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-[(2S)-1-oxo-1-phenylpropan-2-yl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-[(2S)-1-oxo-1-phenylpropan-2-yl]indol-2-one |
|---|---|
| PubChem CID | 7281362 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-[(2S)-1-oxo-1-phenylpropan-2-yl]indol-2-one |
| SMILES | Cc1ccc(CN2C(=O)[C@@](O)([C@H](C)C(=O)c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H23NO3/c1-17-12-14-19(15-13-17)16-26-22-11-7-6-10-21(22)25(29,24(26)28)18(2)23(27)20-8-4-3-5-9-20/h3-15,18,29H,16H2,1-2H3/t18-,25-/m1/s1 |
| InChIKey | OODZZHOFDHQZKG-IQGLISFBSA-N |
| XLogP | 4.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |