C19H18NO4- — CID 57374959
2-(1-benzyl-3-hydroxy-2-oxoindol-3-yl)butanoate (PubChem CID 57374959) has the molecular formula C19H18NO4- and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-(1-benzyl-3-hydroxy-2-oxoindol-3-yl)butanoate.
| Compound Name | 2-(1-benzyl-3-hydroxy-2-oxoindol-3-yl)butanoate |
|---|---|
| PubChem CID | 57374959 |
| Molecular Formula | C19H18NO4- |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-(1-benzyl-3-hydroxy-2-oxoindol-3-yl)butanoate |
| SMILES | CCC(C(=O)[O-])C1(O)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H19NO4/c1-2-14(17(21)22)19(24)15-10-6-7-11-16(15)20(18(19)23)12-13-8-4-3-5-9-13/h3-11,14,24H,2,12H2,1H3,(H,21,22)/p-1 |
| InChIKey | WPGXIIDTZFOFSF-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |