C30H25BrN2O4S — CID 134949211
N-[(1R)-1-[(3R)-1-benzyl-3-bromo-2-oxoindol-3-yl]-2-oxo-2-phenylethyl]-4-methylbenzenesulfonamide (PubChem CID 134949211) has the molecular formula C30H25BrN2O4S and a molecular weight of 589.51 g/mol. Its IUPAC name is N-[(1R)-1-[(3R)-1-benzyl-3-bromo-2-oxoindol-3-yl]-2-oxo-2-phenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-[(3R)-1-benzyl-3-bromo-2-oxoindol-3-yl]-2-oxo-2-phenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134949211 |
| Molecular Formula | C30H25BrN2O4S |
| Molecular Weight | 589.51 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | N-[(1R)-1-[(3R)-1-benzyl-3-bromo-2-oxoindol-3-yl]-2-oxo-2-phenylethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C(=O)c2ccccc2)[C@@]2(Br)C(=O)N(Cc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H25BrN2O4S/c1-21-16-18-24(19-17-21)38(36,37)32-28(27(34)23-12-6-3-7-13-23)30(31)25-14-8-9-15-26(25)33(29(30)35)20-22-10-4-2-5-11-22/h2-19,28,32H,20H2,1H3/t28-,30-/m1/s1 |
| InChIKey | LRUFJBNVAGWUIO-PQHLKRTFSA-N |
| XLogP | 5.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|