C31H35N3O5S — CID 178048085
4-[1-[[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)phenyl]methyl]-3-hydroxy-2-oxoindol-3-yl]-N-tert-butylbenzenesulfonamide (PubChem CID 178048085) has the molecular formula C31H35N3O5S and a molecular weight of 561.70 g/mol. Its IUPAC name is 4-[1-[[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)phenyl]methyl]-3-hydroxy-2-oxoindol-3-yl]-N-tert-butylbenzenesulfonamide.
| Compound Name | 4-[1-[[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)phenyl]methyl]-3-hydroxy-2-oxoindol-3-yl]-N-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 178048085 |
| Molecular Formula | C31H35N3O5S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 4-[1-[[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)phenyl]methyl]-3-hydroxy-2-oxoindol-3-yl]-N-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C2(O)C(=O)N(Cc3ccc(N4CC5COCC5C4)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H35N3O5S/c1-30(2,3)32-40(37,38)26-14-10-24(11-15-26)31(36)27-6-4-5-7-28(27)34(29(31)35)16-21-8-12-25(13-9-21)33-17-22-19-39-20-23(22)18-33/h4-15,22-23,32,36H,16-20H2,1-3H3 |
| InChIKey | XLSQNBKFUIXDCT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|