C21H16FNO2 — CID 95095514
(3S)-1-[(3-fluorophenyl)methyl]-3-hydroxy-3-phenylindol-2-one (PubChem CID 95095514) has the molecular formula C21H16FNO2 and a molecular weight of 333.36 g/mol. Its IUPAC name is (3S)-1-[(3-fluorophenyl)methyl]-3-hydroxy-3-phenylindol-2-one.
| Compound Name | (3S)-1-[(3-fluorophenyl)methyl]-3-hydroxy-3-phenylindol-2-one |
|---|---|
| PubChem CID | 95095514 |
| Molecular Formula | C21H16FNO2 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (3S)-1-[(3-fluorophenyl)methyl]-3-hydroxy-3-phenylindol-2-one |
| SMILES | O=C1N(Cc2cccc(F)c2)c2ccccc2[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C21H16FNO2/c22-17-10-6-7-15(13-17)14-23-19-12-5-4-11-18(19)21(25,20(23)24)16-8-2-1-3-9-16/h1-13,25H,14H2/t21-/m0/s1 |
| InChIKey | BZBDJFNDDNZHRT-NRFANRHFSA-N |
| XLogP | 3.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |