C22H17F2NO3 — CID 95095417
(3S)-1-[2-(4-fluorophenoxy)ethyl]-3-(3-fluorophenyl)-3-hydroxyindol-2-one (PubChem CID 95095417) has the molecular formula C22H17F2NO3 and a molecular weight of 381.38 g/mol. Its IUPAC name is (3S)-1-[2-(4-fluorophenoxy)ethyl]-3-(3-fluorophenyl)-3-hydroxyindol-2-one.
| Compound Name | (3S)-1-[2-(4-fluorophenoxy)ethyl]-3-(3-fluorophenyl)-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 95095417 |
| Molecular Formula | C22H17F2NO3 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (3S)-1-[2-(4-fluorophenoxy)ethyl]-3-(3-fluorophenyl)-3-hydroxyindol-2-one |
| SMILES | O=C1N(CCOc2ccc(F)cc2)c2ccccc2[C@@]1(O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H17F2NO3/c23-16-8-10-18(11-9-16)28-13-12-25-20-7-2-1-6-19(20)22(27,21(25)26)15-4-3-5-17(24)14-15/h1-11,14,27H,12-13H2/t22-/m0/s1 |
| InChIKey | IRWHMOQZGLIXKC-QFIPXVFZSA-N |
| XLogP | 3.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |