C22H15FN2O2 — CID 95095371
3-[[(3S)-3-(3-fluorophenyl)-3-hydroxy-2-oxoindol-1-yl]methyl]benzonitrile (PubChem CID 95095371) has the molecular formula C22H15FN2O2 and a molecular weight of 358.37 g/mol. Its IUPAC name is 3-[[(3S)-3-(3-fluorophenyl)-3-hydroxy-2-oxoindol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[(3S)-3-(3-fluorophenyl)-3-hydroxy-2-oxoindol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 95095371 |
| Molecular Formula | C22H15FN2O2 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-[[(3S)-3-(3-fluorophenyl)-3-hydroxy-2-oxoindol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2C(=O)[C@](O)(c3cccc(F)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C22H15FN2O2/c23-18-8-4-7-17(12-18)22(27)19-9-1-2-10-20(19)25(21(22)26)14-16-6-3-5-15(11-16)13-24/h1-12,27H,14H2/t22-/m0/s1 |
| InChIKey | CKHZEKWKXUEUPB-QFIPXVFZSA-N |
| XLogP | 3.48 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |