C23H21NO3 — CID 95095280
(3R)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-(4-methylphenyl)indol-2-one (PubChem CID 95095280) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-(4-methylphenyl)indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-(4-methylphenyl)indol-2-one |
|---|---|
| PubChem CID | 95095280 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (3R)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-(4-methylphenyl)indol-2-one |
| SMILES | COc1cccc(CN2C(=O)[C@@](O)(c3ccc(C)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C23H21NO3/c1-16-10-12-18(13-11-16)23(26)20-8-3-4-9-21(20)24(22(23)25)15-17-6-5-7-19(14-17)27-2/h3-14,26H,15H2,1-2H3/t23-/m1/s1 |
| InChIKey | GYLLUKIZEKDVLT-HSZRJFAPSA-N |
| XLogP | 3.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |