C24H22N2O5 — CID 53144251
N-(3,5-dimethoxyphenyl)-2-(3-hydroxy-2-oxo-3-phenylindol-1-yl)acetamide (PubChem CID 53144251) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-(3-hydroxy-2-oxo-3-phenylindol-1-yl)acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-(3-hydroxy-2-oxo-3-phenylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 53144251 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-(3-hydroxy-2-oxo-3-phenylindol-1-yl)acetamide |
| SMILES | COc1cc(NC(=O)CN2C(=O)C(O)(c3ccccc3)c3ccccc32)cc(OC)c1 |
| InChI | InChI=1S/C24H22N2O5/c1-30-18-12-17(13-19(14-18)31-2)25-22(27)15-26-21-11-7-6-10-20(21)24(29,23(26)28)16-8-4-3-5-9-16/h3-14,29H,15H2,1-2H3,(H,25,27) |
| InChIKey | FYGOMBIPONZKOS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |